EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H17NO2S |
| Net Charge | 0 |
| Average Mass | 251.351 |
| Monoisotopic Mass | 251.09800 |
| SMILES | CC(C)C=CC=C[C@H](C)c1nc(C(=O)O)cs1 |
| InChI | InChI=1S/C13H17NO2S/c1-9(2)6-4-5-7-10(3)12-14-11(8-17-12)13(15)16/h4-10H,1-3H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | MZDDJMJPPQGIRI-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus (ncbitaxon:32) | - | PubMed (24690915) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Myxothiazol S2 (CHEBI:201341) is a aromatic carboxylic acid (CHEBI:33859) |
| Myxothiazol S2 (CHEBI:201341) is a thiazoles (CHEBI:48901) |
| IUPAC Name |
|---|
| 2-[(2S)-7-methylocta-3,5-dien-2-yl]-1,3-thiazole-4-carboxylic acid |