EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O8 |
| Net Charge | 0 |
| Average Mass | 366.366 |
| Monoisotopic Mass | 366.13147 |
| SMILES | CO[C@@]1(C)[C@H](O)C(O)=C(C)C(=O)[C@@H]1Oc1c(C)c(O)cc(C)c1C(=O)O |
| InChI | InChI=1S/C18H22O8/c1-7-6-10(19)8(2)14(11(7)17(23)24)26-16-13(21)9(3)12(20)15(22)18(16,4)25-5/h6,15-16,19-20,22H,1-5H3,(H,23,24)/t15-,16+,18+/m1/s1 |
| InChIKey | OFAIPEZAGBTTCZ-RYRKJORJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (27537356) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Roseopurpurin A (CHEBI:201237) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| 2-[(1R,5R,6S)-4,5-dihydroxy-6-methoxy-3,6-dimethyl-2-oxocyclohex-3-en-1-yl]oxy-4-hydroxy-3,6-dimethylbenzoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440103 | ChemSpider |