EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H31NO10 |
| Net Charge | 0 |
| Average Mass | 541.553 |
| Monoisotopic Mass | 541.19480 |
| SMILES | CC[C@@]1(O)C[C@H](OC2CC(N)C(O)C(C)O2)c2c(cc3c(c2O)C(=O)c2c(O)cccc2C3=O)[C@H]1C(=O)OC |
| InChI | InChI=1S/C28H31NO10/c1-4-28(36)10-17(39-18-9-15(29)23(31)11(2)38-18)20-13(22(28)27(35)37-3)8-14-21(26(20)34)25(33)19-12(24(14)32)6-5-7-16(19)30/h5-8,11,15,17-18,22-23,30-31,34,36H,4,9-10,29H2,1-3H3/t11?,15?,17-,18?,22-,23?,28+/m0/s1 |
| InChIKey | MCWLCHNOMBKWNJ-CUNXHAHNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces coeruleorubidus (ncbitaxon:116188) | - | PubMed (7451367) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MA-144-KH (CHEBI:201234) is a anthracycline (CHEBI:48120) |
| IUPAC Name |
|---|
| methyl (1R,2R,4S)-4-(4-amino-5-hydroxy-6-methyloxan-2-yl)oxy-2-ethyl-2,5,7-trihydroxy-6,11-dioxo-3,4-dihydro-1H-tetracene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78445082 | ChemSpider |