EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N2O6 |
| Net Charge | 0 |
| Average Mass | 370.446 |
| Monoisotopic Mass | 370.21039 |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)C1OC(=O)C1C(C)C)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H30N2O6/c1-7-10(6)13(17(23)24)20-15(21)12(9(4)5)19-16(22)14-11(8(2)3)18(25)26-14/h8-14H,7H2,1-6H3,(H,19,22)(H,20,21)(H,23,24)/t10-,11?,12-,13-,14?/m0/s1 |
| InChIKey | LYUCHIIJQVXUQP-NBWCBLLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora cystarginea (ncbitaxon:58350) | - | PubMed (25769015) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cystargolide A (CHEBI:201209) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3S)-3-methyl-2-[[(2S)-3-methyl-2-[(4-oxo-3-propan-2-yloxetane-2-carbonyl)amino]butanoyl]amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 59006007 | ChemSpider |