EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O3 |
| Net Charge | 0 |
| Average Mass | 250.298 |
| Monoisotopic Mass | 250.13174 |
| SMILES | COC(=O)/C=C/c1ncn(C)c1C/C=C(\C)CO |
| InChI | InChI=1S/C13H18N2O3/c1-10(8-16)4-6-12-11(14-9-15(12)2)5-7-13(17)18-3/h4-5,7,9,16H,6,8H2,1-3H3/b7-5+,10-4+ |
| InChIKey | ISZRKETYAXFJGG-DLWSCZCPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Metarhizium (ncbitaxon:5529) | - | PubMed (16506697) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hydroxyfungerin A (CHEBI:201198) is a imidazolyl carboxylic acid (CHEBI:38307) |
| IUPAC Name |
|---|
| methyl (E)-3-[5-[(E)-4-hydroxy-3-methylbut-2-enyl]-1-methylimidazol-4-yl]prop-2-enoate |
| Manual Xrefs | Databases |
|---|---|
| 64895960 | ChemSpider |