EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H16O5 |
| Net Charge | 0 |
| Average Mass | 324.332 |
| Monoisotopic Mass | 324.09977 |
| SMILES | C[C@]12C[C@H](O)[C@H](O)c3coc(c31)C(=O)c1c2ccc2c1CCC2=O |
| InChI | InChI=1S/C19H16O5/c1-19-6-13(21)16(22)10-7-24-18(15(10)19)17(23)14-9-3-5-12(20)8(9)2-4-11(14)19/h2,4,7,13,16,21-22H,3,5-6H2,1H3/t13-,16+,19+/m0/s1 |
| InChIKey | OMFRFNKENPVEGO-URKNILKWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hymenoscyphus fraxineus (ncbitaxon:746836) | - | PubMed (23098903) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxy-2-demethyl-viridiol (CHEBI:201179) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,16R,17S)-16,17-dihydroxy-1-methyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),3,5(9),12(19),14-pentaene-6,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 78441994 | ChemSpider |