EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O8 |
| Net Charge | 0 |
| Average Mass | 390.388 |
| Monoisotopic Mass | 390.13147 |
| SMILES | COc1c2c(c(OC)c(-c3c(C)c(OC)c4c(c3OC)OCO4)c1C)OCO2 |
| InChI | InChI=1S/C20H22O8/c1-9-11(15(23-5)19-17(13(9)21-3)25-7-27-19)12-10(2)14(22-4)18-20(16(12)24-6)28-8-26-18/h7-8H2,1-6H3 |
| InChIKey | HNKLCRIFLSAYAM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antrodia cinnamomea (ncbitaxon:279009) | - | DOI (10.1016/0031-9422(95)00025-3) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,2',5,5'-tetramethoxy-3,4,3'4'-bi-methylenedioxy-6,6'-dimethylbiphenyl (CHEBI:201158) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 5-(4,7-dimethoxy-6-methyl-1,3-benzodioxol-5-yl)-4,7-dimethoxy-6-methyl-1,3-benzodioxole |
| Manual Xrefs | Databases |
|---|---|
| 343875 | ChemSpider |