EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42N4O6 |
| Net Charge | 0 |
| Average Mass | 506.644 |
| Monoisotopic Mass | 506.31044 |
| SMILES | C=C1/C=C\C(=O)N(C)CC(=O)NC(CCC(N)=O)C(=O)OC(C(C)CC(C)CC(C)C)C(C)C(=O)N1 |
| InChI | InChI=1S/C26H42N4O6/c1-15(2)12-16(3)13-17(4)24-19(6)25(34)28-18(5)8-11-23(33)30(7)14-22(32)29-20(26(35)36-24)9-10-21(27)31/h8,11,15-17,19-20,24H,5,9-10,12-14H2,1-4,6-7H3,(H2,27,31)(H,28,34)(H,29,32)/b11-8- |
| InChIKey | QWJSJIQOPXXDQH-FLIBITNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | DOI (10.1002/1099-0690(200010)2000:19<3353::aid-ejoc3353>3.0.co;2-e) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Rakicidin C (CHEBI:201092) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| 3-[(9E)-15-(4,6-dimethylheptan-2-yl)-7,14-dimethyl-11-methylidene-2,5,8,13-tetraoxo-1-oxa-4,7,12-triazacyclopentadec-9-en-3-yl]propanamide |
| Manual Xrefs | Databases |
|---|---|
| 8800768 | ChemSpider |