EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N4O6 |
| Net Charge | 0 |
| Average Mass | 434.493 |
| Monoisotopic Mass | 434.21653 |
| SMILES | CC(C)C[C@H]1NC(=O)[C@@H](C)NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)[C@@H](CO)NC1=O |
| InChI | InChI=1S/C21H30N4O6/c1-11(2)8-15-20(30)25-17(10-26)21(31)24-16(9-13-4-6-14(27)7-5-13)19(29)22-12(3)18(28)23-15/h4-7,11-12,15-17,26-27H,8-10H2,1-3H3,(H,22,29)(H,23,28)(H,24,31)(H,25,30)/t12-,15-,16-,17-/m1/s1 |
| InChIKey | LJRJAZMYNGHLGX-BASLNEPJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brevibacterium (ncbitaxon:1696) | - | PubMed (26214049) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclic-(Tyr-Ala-Leu-Ser) (CHEBI:201091) is a cyclic peptide (CHEBI:23449) |
| IUPAC Name |
|---|
| (3R,6R,9R,12R)-3-(hydroxymethyl)-12-[(4-hydroxyphenyl)methyl]-9-methyl-6-(2-methylpropyl)-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 58196412 | ChemSpider |