EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N4O7 |
| Net Charge | 0 |
| Average Mass | 504.584 |
| Monoisotopic Mass | 504.25840 |
| SMILES | CC(C)C(NC(=O)C(O)C(N)Cc1ccccc1)C(=O)N1CCCC1C(=O)N1C[C@@H](O)CC1C(=O)O |
| InChI | InChI=1S/C25H36N4O7/c1-14(2)20(27-22(32)21(31)17(26)11-15-7-4-3-5-8-15)24(34)28-10-6-9-18(28)23(33)29-13-16(30)12-19(29)25(35)36/h3-5,7-8,14,16-21,30-31H,6,9-13,26H2,1-2H3,(H,27,32)(H,35,36)/t16-,17?,18?,19?,20?,21?/m0/s1 |
| InChIKey | SWITUXFHGUGTCX-YADZBRFQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (8609096) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| MR-387-A (CHEBI:201043) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (4S)-1-[1-[2-[(3-amino-2-hydroxy-4-phenylbutanoyl)amino]-3-methylbutanoyl]pyrrolidine-2-carbonyl]-4-hydroxypyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445581 | ChemSpider |