EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H25NO7 |
| Net Charge | 0 |
| Average Mass | 427.453 |
| Monoisotopic Mass | 427.16310 |
| SMILES | CC(C)=CCc1c(OC(=O)c2c(C)cc(O)cc2O)cc2c(c1O)CN(CCO)C2=O |
| InChI | InChI=1S/C23H25NO7/c1-12(2)4-5-15-19(31-23(30)20-13(3)8-14(26)9-18(20)27)10-16-17(21(15)28)11-24(6-7-25)22(16)29/h4,8-10,25-28H,5-7,11H2,1-3H3 |
| InChIKey | HVNLWMCBYLOMFO-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stereum (ncbitaxon:5644) | - | PubMed (18503190) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sterenin A (CHEBI:201041) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| [7-hydroxy-2-(2-hydroxyethyl)-6-(3-methylbut-2-enyl)-3-oxo-1H-isoindol-5-yl] 2,4-dihydroxy-6-methylbenzoate |
| Manual Xrefs | Databases |
|---|---|
| 28285091 | ChemSpider |