EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31N5O11S |
| Net Charge | 0 |
| Average Mass | 597.603 |
| Monoisotopic Mass | 597.17408 |
| SMILES | C[C@H](N)C(=O)N1CC[C@@H](O)[C@H]1C(=O)N[C@H]1COC(=O)c2cc(O)cc(O)c2CSC[C@@H](C(=O)NCC(=O)O)NC1=O |
| InChI | InChI=1S/C24H31N5O11S/c1-10(25)23(38)29-3-2-16(31)19(29)22(37)27-14-7-40-24(39)12-4-11(30)5-17(32)13(12)8-41-9-15(28-21(14)36)20(35)26-6-18(33)34/h4-5,10,14-16,19,30-32H,2-3,6-9,25H2,1H3,(H,26,35)(H,27,37)(H,28,36)(H,33,34)/t10-,14-,15-,16+,19-/m0/s1 |
| InChIKey | QGZCMTZWELAYOU-HCYVDOCESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (9207910) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cyclothialidine D (CHEBI:201034) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-[[(5R,8S)-8-[[(2S,3R)-1-[(2S)-2-aminopropanoyl]-3-hydroxypyrrolidine-2-carbonyl]amino]-14,16-dihydroxy-7,11-dioxo-10-oxa-3-thia-6-azabicyclo[10.4.0]hexadeca-1(12),13,15-triene-5-carbonyl]amino]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 8992637 | ChemSpider |