EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N2O7 |
| Net Charge | 0 |
| Average Mass | 434.489 |
| Monoisotopic Mass | 434.20530 |
| SMILES | C[C@@H](CC(=O)NC(=O)c1cnc(/C=C\CCCCCCCCC(=O)O)cc1=O)C(=O)O |
| InChI | InChI=1S/C22H30N2O7/c1-15(22(30)31)12-19(26)24-21(29)17-14-23-16(13-18(17)25)10-8-6-4-2-3-5-7-9-11-20(27)28/h8,10,13-15H,2-7,9,11-12H2,1H3,(H,23,25)(H,27,28)(H,30,31)(H,24,26,29)/b10-8-/t15-/m0/s1 |
| InChIKey | NJUIBIWJAXMJKR-WWRUEGTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (23302594) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Himeic acid E (CHEBI:200978) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (Z)-11-[5-[[(3S)-3-carboxybutanoyl]carbamoyl]-4-oxo-1H-pyridin-2-yl]undec-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 29215338 | ChemSpider |