EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H31NO4 |
| Net Charge | 0 |
| Average Mass | 361.482 |
| Monoisotopic Mass | 361.22531 |
| SMILES | CC1CCC2C(C=CC(C)C2(C)C(O)=C2C(=O)C(C(C)O)N(C)C2=O)C1 |
| InChI | InChI=1S/C21H31NO4/c1-11-6-9-15-14(10-11)8-7-12(2)21(15,4)19(25)16-18(24)17(13(3)23)22(5)20(16)26/h7-8,11-15,17,23,25H,6,9-10H2,1-5H3 |
| InChIKey | LVWQDHHIWXPCLH-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pezicula (ncbitaxon:101853) | - | PubMed (11918060) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CJ-17,572 (CHEBI:200957) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| 5-(1-hydroxyethyl)-3-[hydroxy-(1,2,6-trimethyl-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl)methylidene]-1-methylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78443967 | ChemSpider |