EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25ClN4O8 |
| Net Charge | 0 |
| Average Mass | 460.871 |
| Monoisotopic Mass | 460.13609 |
| SMILES | NCCC[C@@H](NC(=O)c1ccc(Cl)c(O)c1O)C(=O)N[C@H](CCCN(O)C=O)C(=O)O |
| InChI | InChI=1S/C18H25ClN4O8/c19-11-6-5-10(14(25)15(11)26)16(27)21-12(3-1-7-20)17(28)22-13(18(29)30)4-2-8-23(31)9-24/h5-6,9,12-13,25-26,31H,1-4,7-8,20H2,(H,21,27)(H,22,28)(H,29,30)/t12-,13-/m1/s1 |
| InChIKey | AIPMDKSFYQRSQQ-CHWSQXEVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (25408968) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chlorocatechelin B (CHEBI:200932) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2R)-2-[[(2R)-5-amino-2-[(4-chloro-2,3-dihydroxybenzoyl)amino]pentanoyl]amino]-5-[ormyl(hydroxy)amino]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78436695 | ChemSpider |