EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N3O4 |
| Net Charge | 0 |
| Average Mass | 241.247 |
| Monoisotopic Mass | 241.10626 |
| SMILES | C=C1C[C@@H](C(=O)N[C@H](C(=O)O)[C@@H](C)O)N=C1N |
| InChI | InChI=1S/C10H15N3O4/c1-4-3-6(12-8(4)11)9(15)13-7(5(2)14)10(16)17/h5-7,14H,1,3H2,2H3,(H2,11,12)(H,13,15)(H,16,17)/t5-,6+,7+/m1/s1 |
| InChIKey | BQWZMMMOWXGNRM-VQVTYTSYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia plantarii (ncbitaxon:41899) | - | PubMed (16172692) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-imino-3-methylene-5-L-(carboxy-L-threoninyl)pyrrolidine (CHEBI:200928) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(2S)-5-amino-4-methylidene-2,3-dihydropyrrole-2-carbonyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9667252 | ChemSpider |