EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H13NO5S |
| Net Charge | 0 |
| Average Mass | 307.327 |
| Monoisotopic Mass | 307.05144 |
| SMILES | O=C(S[C@]12CC[C@H](O)[C@H]1C(=O)NC2=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C14H13NO5S/c16-8-3-1-7(2-4-8)12(19)21-14-6-5-9(17)10(14)11(18)15-13(14)20/h1-4,9-10,16-17H,5-6H2,(H,15,18,20)/t9-,10-,14+/m0/s1 |
| InChIKey | NVPUUGMGKVACBE-PKFCDNJMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces nitrosporeus (ncbitaxon:28894) | - | PubMed (24090410) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nitrosporeusine B (CHEBI:200892) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| S-[(3aR,6S,6aS)-6-hydroxy-1,3-dioxo-4,5,6,6a-tetrahydrocyclopenta[c]pyrrol-3a-yl] 4-hydroxybenzenecarbothioate |
| Manual Xrefs | Databases |
|---|---|
| 30771398 | ChemSpider |