EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11NO4 |
| Net Charge | 0 |
| Average Mass | 221.212 |
| Monoisotopic Mass | 221.06881 |
| SMILES | O=C1C[C@@](Cc2ccc(O)cc2)(C(=O)O)N1 |
| InChI | InChI=1S/C11H11NO4/c13-8-3-1-7(2-4-8)5-11(10(15)16)6-9(14)12-11/h1-4,13H,5-6H2,(H,12,14)(H,15,16)/t11-/m0/s1 |
| InChIKey | IPIBASNVKYAKDN-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces morookaense (ncbitaxon:1970) | - | PubMed (17446689) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Streptoverticillinone (CHEBI:200884) is a benzenes (CHEBI:22712) |
| Streptoverticillinone (CHEBI:200884) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| (2S)-2-[(4-hydroxyphenyl)methyl]-4-oxoazetidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 17284101 | ChemSpider |