EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | C[C@H]([C@@H]1CC[C@@H](C)C(=O)O1)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@@H](O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C30H48O3/c1-18-8-10-23(33-26(18)32)19(2)20-12-16-30(7)22-9-11-24-27(3,4)25(31)14-15-28(24,5)21(22)13-17-29(20,30)6/h18-20,23-25,31H,8-17H2,1-7H3/t18-,19+,20-,23+,24?,25-,28-,29-,30+/m1/s1 |
| InChIKey | RAVLYMWHELNCTR-MAKMCECFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Astraeus odoratus (ncbitaxon:265491) | - | PubMed (22957940) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Artabotryol A (CHEBI:200830) is a withanolide (CHEBI:74716) |
| IUPAC Name |
|---|
| (3R,6S)-6-[(1S)-1-[(3R,10S,13R,14R,17R)-3-hydroxy-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-3-methyloxan-2-one |
| Manual Xrefs | Databases |
|---|---|
| 78436682 | ChemSpider |