EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O4 |
| Net Charge | 0 |
| Average Mass | 362.510 |
| Monoisotopic Mass | 362.24571 |
| SMILES | C[C@@H]1[C@H](O)CC[C@]2(C)C3=C(C(=O)C[C@@H]12)[C@@H]1CC[C@](O)([C@@H](C)O)[C@@]1(C)CC3 |
| InChI | InChI=1S/C22H34O4/c1-12-16-11-18(25)19-14(20(16,3)8-7-17(12)24)5-9-21(4)15(19)6-10-22(21,26)13(2)23/h12-13,15-17,23-24,26H,5-11H2,1-4H3/t12-,13+,15-,16-,17+,20+,21-,22-/m0/s1 |
| InChIKey | MHAYDOHKEQXCEG-GLVQIBCTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phellinus igniarius (ncbitaxon:40472) | - | PubMed (20583752) |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (3R,4S,5S,17R,20R)-3,17,20-trihydroxy-4-methylpregn-8-en-7-one (CHEBI:200804) has role androgen (CHEBI:50113) |
| (3R,4S,5S,17R,20R)-3,17,20-trihydroxy-4-methylpregn-8-en-7-one (CHEBI:200804) is a 3-hydroxy steroid (CHEBI:36834) |
| IUPAC Name |
|---|
| (3R,4S,5S,10S,13S,14R,17R)-3,17-dihydroxy-17-[(1R)-1-hydroxyethyl]-4,10,13-trimethyl-2,3,4,5,6,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-7-one |
| Manual Xrefs | Databases |
|---|---|
| 28287922 | ChemSpider |