EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23NO5 |
| Net Charge | 0 |
| Average Mass | 321.373 |
| Monoisotopic Mass | 321.15762 |
| SMILES | NC(=O)c1coc(/C=C/CCCCCCCCC(=O)O)cc1=O |
| InChI | InChI=1S/C17H23NO5/c18-17(22)14-12-23-13(11-15(14)19)9-7-5-3-1-2-4-6-8-10-16(20)21/h7,9,11-12H,1-6,8,10H2,(H2,18,22)(H,20,21)/b9-7+ |
| InChIKey | CFCNZKAZHHLTLD-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillusspecies (ncbitaxon:5065) | - | PubMed (15582438) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Himeic acid B (CHEBI:200734) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (E)-11-(5-carbamoyl-4-oxopyran-2-yl)undec-10-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 10191862 | ChemSpider |