EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H22O6 |
| Net Charge | 0 |
| Average Mass | 322.357 |
| Monoisotopic Mass | 322.14164 |
| SMILES | COc1cc(O)c2c(c1O)C[C@H](C[C@H]1CCC[C@H](C)O1)OC2=O |
| InChI | InChI=1S/C17H22O6/c1-9-4-3-5-10(22-9)6-11-7-12-15(17(20)23-11)13(18)8-14(21-2)16(12)19/h8-11,18-19H,3-7H2,1-2H3/t9-,10+,11-/m0/s1 |
| InChIKey | UOABJMSKCCCLDH-AXFHLTTASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus (ncbitaxon:5052) | - | PubMed (25517217) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyl-6-O-methylasperentin (CHEBI:200724) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-5,8-dihydroxy-6-methoxy-3-[[(2R,6S)-6-methyloxan-2-yl]methyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 34981951 | ChemSpider |