EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18O5 |
| Net Charge | 0 |
| Average Mass | 338.359 |
| Monoisotopic Mass | 338.11542 |
| SMILES | CO[C@H]1C[C@]2(C)c3ccc4c(c3C(=O)c3occ(c32)[C@H]1O)CCC4=O |
| InChI | InChI=1S/C20H18O5/c1-20-7-14(24-2)17(22)11-8-25-19(16(11)20)18(23)15-10-4-6-13(21)9(10)3-5-12(15)20/h3,5,8,14,17,22H,4,6-7H2,1-2H3/t14-,17+,20+/m0/s1 |
| InChIKey | FRKJGFHTBOKCKM-JNAXZKDPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hymenoscyphus fraxineus (ncbitaxon:746836) | - | PubMed (23098903) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-deoxyviridiol (CHEBI:200719) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,16R,17S)-16-hydroxy-17-methoxy-1-methyl-13-oxapentacyclo[10.6.1.02,10.05,9.015,19]nonadeca-2(10),3,5(9),12(19),14-pentaene-6,11-dione |
| Manual Xrefs | Databases |
|---|---|
| 78441990 | ChemSpider |