EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N7O3 |
| Net Charge | 0 |
| Average Mass | 307.314 |
| Monoisotopic Mass | 307.13929 |
| SMILES | C[C@@H](N)C(=O)N[C@@H](CCn1cnc2c(N)ncnc21)C(=O)O |
| InChI | InChI=1S/C12H17N7O3/c1-6(13)11(20)18-7(12(21)22)2-3-19-5-17-8-9(14)15-4-16-10(8)19/h4-7H,2-3,13H2,1H3,(H,18,20)(H,21,22)(H2,14,15,16)/t6-,7+/m1/s1 |
| InChIKey | CXQBUSHAZPWJIG-RQJHMYQMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromycesspecies (ncbitaxon:1707706) | - | PubMed (8557612) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NK374200 (CHEBI:200711) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[(2R)-2-aminopropanoyl]amino]-4-(6-aminopurin-9-yl)butanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8670326 | ChemSpider |