EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H35ClN10O10 |
| Net Charge | 0 |
| Average Mass | 659.057 |
| Monoisotopic Mass | 658.22262 |
| SMILES | NC(=O)OCC(O)CC(NC(=O)C1NCCCC1O)C(=O)NC(Cc1cnc(N)n1)C(=O)NC(C(=O)O)C(O)c1ncc(Cl)n1 |
| InChI | InChI=1S/C24H35ClN10O10/c25-14-7-29-18(34-14)17(38)16(22(42)43)35-20(40)11(4-9-6-30-23(26)31-9)32-19(39)12(5-10(36)8-45-24(27)44)33-21(41)15-13(37)2-1-3-28-15/h6-7,10-13,15-17,28,36-38H,1-5,8H2,(H2,27,44)(H,29,34)(H,32,39)(H,33,41)(H,35,40)(H,42,43)(H3,26,30,31) |
| InChIKey | XUPLSXHPJUYVNP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (16380421) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GE81112 (CHEBI:200707) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| 2-[[3-(2-amino-1H-imidazol-5-yl)-2-[[5-carbamoyloxy-4-hydroxy-2-[(3-hydroxypiperidine-2-carbonyl)amino]pentanoyl]amino]propanoyl]amino]-3-(5-chloro-1H-imidazol-2-yl)-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9753104 | ChemSpider |