EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13N3O5 |
| Net Charge | 0 |
| Average Mass | 291.263 |
| Monoisotopic Mass | 291.08552 |
| SMILES | CC(=O)N[C@H](Cc1cnc2cccc([N+](=O)[O-])c12)C(=O)O |
| InChI | InChI=1S/C13H13N3O5/c1-7(17)15-10(13(18)19)5-8-6-14-9-3-2-4-11(12(8)9)16(20)21/h2-4,6,10,14H,5H2,1H3,(H,15,17)(H,18,19)/t10-/m1/s1 |
| InChIKey | PPBXRRAOLBQTEB-SNVBAGLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces scabiei (ncbitaxon:1930) | - | DOI (10.1016/0031-9422(95)00256-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Acetyl-4-nitrotryptophan (CHEBI:200689) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (2R)-2-acetamido-3-(4-nitro-1H-indol-3-yl)propanoic acid |