EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H24O3 |
| Net Charge | 0 |
| Average Mass | 288.387 |
| Monoisotopic Mass | 288.17254 |
| SMILES | CC1CC(C)C2C(=O)C(C)(/C=C/C=C/C(=O)O)C=CC2C1 |
| InChI | InChI=1S/C18H24O3/c1-12-10-13(2)16-14(11-12)7-9-18(3,17(16)21)8-5-4-6-15(19)20/h4-9,12-14,16H,10-11H2,1-3H3,(H,19,20)/b6-4+,8-5+ |
| InChIKey | NUIMPRVESYOKAD-HLQBBKRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (8294243) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Hynapene C (CHEBI:200593) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-(2,6,8-trimethyl-1-oxo-4a,5,6,7,8,8a-hexahydronaphthalen-2-yl)penta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4947684 | ChemSpider |