EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H54O7 |
| Net Charge | 0 |
| Average Mass | 574.799 |
| Monoisotopic Mass | 574.38695 |
| SMILES | CC(=O)O[C@H](C[C@@H](OC(C)=O)C(C)(C)O)[C@@H](C)C1CC[C@@]2(C)[C@@H]3CC=C4[C@@H](CCC(=O)C4(C)C)[C@]3(C)CC[C@]12CO |
| InChI | InChI=1S/C34H54O7/c1-20(26(40-21(2)36)18-29(31(6,7)39)41-22(3)37)23-14-15-33(9)27-12-10-24-25(11-13-28(38)30(24,4)5)32(27,8)16-17-34(23,33)19-35/h10,20,23,25-27,29,35,39H,11-19H2,1-9H3/t20-,23?,25+,26+,27+,29+,32-,33-,34-/m0/s1 |
| InChIKey | VNEQIRWUIXRANF-RJQDIVEQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Leucopaxillus gentianeus (ncbitaxon:181998) | - | PubMed (15568769) |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leucopaxillone A (CHEBI:200582) is a cucurbitacin (CHEBI:16219) |
| IUPAC Name |
|---|
| [(2S,3R,5R)-5-acetyloxy-6-hydroxy-2-[(8R,9R,10S,13S,14S)-13-(hydroxymethyl)-4,4,9,14-tetramethyl-3-oxo-1,2,7,8,10,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl]-6-methylheptan-3-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 9653518 | ChemSpider |