EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N7O10 |
| Net Charge | 0 |
| Average Mass | 615.600 |
| Monoisotopic Mass | 615.22889 |
| SMILES | NC(=NCCC[C@@H](NC(=O)c1cccc(O)c1O)C(=O)NCC(=O)N[C@H]1CCCN(O)C1=O)NC(=O)c1cccc(O)c1O |
| InChI | InChI=1S/C27H33N7O10/c28-27(33-24(41)15-6-2-10-19(36)22(15)39)29-11-3-7-16(32-23(40)14-5-1-9-18(35)21(14)38)25(42)30-13-20(37)31-17-8-4-12-34(44)26(17)43/h1-2,5-6,9-10,16-17,35-36,38-39,44H,3-4,7-8,11-13H2,(H,30,42)(H,31,37)(H,32,40)(H3,28,29,33,41)/t16-,17+/m1/s1 |
| InChIKey | SDUJQEWEVFATFH-SJORKVTESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rhodococcus (ncbitaxon:1827) | - | PubMed (11508844) | |
| Rhodococcus erythropolis (ncbitaxon:1833) | - | PubMed (24274668) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Heterobactin A (CHEBI:200535) is a oligopeptide (CHEBI:25676) |
| IUPAC Name |
|---|
| N-[(2R)-5-[[amino-[(2,3-dihydroxybenzoyl)amino]methylidene]amino]-1-[[2-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-2-oxoethyl]amino]-1-oxopentan-2-yl]-2,3-dihydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| 30900652 | ChemSpider |