EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H54N2O11 |
| Net Charge | 0 |
| Average Mass | 774.908 |
| Monoisotopic Mass | 774.37276 |
| SMILES | C/C=C/C(O)C(C)(C)C1C/C=C\C2OC2C=CC(OC)Cc2nc(co2)C(=O)OC(C(C)(C)C(O)/C=C/C)C/C=C\C2OC2/C=C\C=C/c2nc(co2)C(=O)O1 |
| InChI | InChI=1S/C43H54N2O11/c1-8-14-34(46)42(3,4)36-20-13-18-32-33(54-32)23-22-27(50-7)24-39-45-29(26-52-39)41(49)56-37(43(5,6)35(47)15-9-2)19-12-17-31-30(53-31)16-10-11-21-38-44-28(25-51-38)40(48)55-36/h8-18,21-23,25-27,30-37,46-47H,19-20,24H2,1-7H3/b14-8+,15-9+,16-10-,17-12-,18-13-,21-11-,23-22? |
| InChIKey | DUKYFBNEOVBQQG-IGVLGHSXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium (ncbitaxon:39643) | - | DOI (10.1002/jlac.199419940802) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Disorazole-E1 (CHEBI:200534) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| (2Z,4Z,9Z,26Z)-12,29-bis[(E)-3-hydroxy-2-methylhex-4-en-2-yl]-20-methoxy-7,13,17,24,30,34-hexaoxa-35,36-diazapentacyclo[30.2.1.115,18.06,8.023,25]hexatriaconta-1(35),2,4,9,15,18(36),21,26,32-nonaene-14,31-dione |