EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O2 |
| Net Charge | 0 |
| Average Mass | 182.223 |
| Monoisotopic Mass | 182.10553 |
| SMILES | CN(C=O)C1C2[C@@H]3CCN2C[C@H]1O3 |
| InChI | InChI=1S/C9H14N2O2/c1-10(5-12)8-7-4-11-3-2-6(13-7)9(8)11/h5-9H,2-4H2,1H3/t6-,7+,8?,9?/m0/s1 |
| InChIKey | YHLKXYXFUCTURZ-MZUZGICHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epichloe uncinata (ncbitaxon:5050) | - | DOI (10.1016/S0031-9422(01)00272-2) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-formylloline (CHEBI:200499) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| N-methyl-N-[(1R,3S)-2-oxa-6-azatricyclo[4.2.1.03,7]nonan-8-yl]ormamide |