EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H14O5 |
| Net Charge | 0 |
| Average Mass | 238.239 |
| Monoisotopic Mass | 238.08412 |
| SMILES | CC[C@H](O)[C@H]1Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C12H14O5/c1-2-8(14)10-4-6-3-7(13)5-9(15)11(6)12(16)17-10/h3,5,8,10,13-15H,2,4H2,1H3/t8-,10+/m0/s1 |
| InChIKey | PQXNDMCJKYKTCM-WCBMZHEXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Setophoma (ncbitaxon:798159) | - | PubMed (25574154) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyrenomycin (CHEBI:200498) is a hydroxybenzoic acid (CHEBI:24676) |
| IUPAC Name |
|---|
| (3R)-6,8-dihydroxy-3-[(1S)-1-hydroxypropyl]-3,4-dihydroisochromen-1-one |
| Manual Xrefs | Databases |
|---|---|
| 35516638 | ChemSpider |