EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H33N3O7 |
| Net Charge | 0 |
| Average Mass | 511.575 |
| Monoisotopic Mass | 511.23185 |
| SMILES | NC(=O)[C@@H]1C[C@@H]2CC[C@H](O)C[C@@H]2N1C(=O)[C@@H](Cc1ccc(O)cc1)NC(=O)[C@H](O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C27H33N3O7/c28-25(35)23-13-17-5-10-20(33)14-22(17)30(23)27(37)21(11-15-1-6-18(31)7-2-15)29-26(36)24(34)12-16-3-8-19(32)9-4-16/h1-4,6-9,17,20-24,31-34H,5,10-14H2,(H2,28,35)(H,29,36)/t17-,20-,21+,22-,23-,24+/m0/s1 |
| InChIKey | UYAGLGONOYOGBB-QECFBVRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microcystis aeruginosa (ncbitaxon:1126) | - | PubMed (24261937) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Aeruginosin DA511 (CHEBI:200457) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3aS,6S,7aS)-6-hydroxy-1-[(2R)-2-[[(2R)-2-hydroxy-3-(4-hydroxyphenyl)propanoyl]amino]-3-(4-hydroxyphenyl)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxamide |
| Manual Xrefs | Databases |
|---|---|
| 31130291 | ChemSpider |