EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32N2O6 |
| Net Charge | 0 |
| Average Mass | 372.462 |
| Monoisotopic Mass | 372.22604 |
| SMILES | CCC(C)/C=C/[C@@H](O)[C@H](O)[C@@H](O)[C@@H](OC)C(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H32N2O6/c1-4-11(2)8-9-13(21)14(22)15(23)16(26-3)18(25)20-12-7-5-6-10-19-17(12)24/h8-9,11-16,21-23H,4-7,10H2,1-3H3,(H,19,24)(H,20,25)/b9-8+/t11?,12-,13+,14-,15+,16+/m0/s1 |
| InChIKey | GPVKLYONJSSZFL-JGTAQRAESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Myxococcus (ncbitaxon:32) | - | PubMed (22705020) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Bengamide E' (CHEBI:200452) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| (E,2R,3R,4S,5R)-3,4,5-trihydroxy-2-methoxy-8-methyl-N-[(3S)-2-oxoazepan-3-yl]dec-6-enamide |
| Manual Xrefs | Databases |
|---|---|
| 9420766 | ChemSpider |