EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO3S |
| Net Charge | 0 |
| Average Mass | 241.312 |
| Monoisotopic Mass | 241.07726 |
| SMILES | CO[C@@H](CC(=O)O)/C(C)=C/c1csc(C)n1 |
| InChI | InChI=1S/C11H15NO3S/c1-7(10(15-3)5-11(13)14)4-9-6-16-8(2)12-9/h4,6,10H,5H2,1-3H3,(H,13,14)/b7-4+/t10-/m0/s1 |
| InChIKey | MTNLUIZVDKCAMF-QBBOHKLWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum (ncbitaxon:56) | - | PubMed (11473410) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methoxycarboxylic acid 42 (CHEBI:200442) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (E)-3-methoxy-4-methyl-5-(2-methyl-1,3-thiazol-4-yl)pent-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9921483 | ChemSpider |