EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H14Cl2O8 |
| Net Charge | 0 |
| Average Mass | 573.340 |
| Monoisotopic Mass | 572.00657 |
| SMILES | Cc1cc(=O)c2c(O)c3c(O)c(Cl)c(O)c4c5c(O)c(Cl)c(O)c6c(O)c7c(=O)cc(C)c8c1c2c(c34)c(c65)c78 |
| InChI | InChI=1S/C30H14Cl2O8/c1-5-3-7(33)11-13-9(5)10-6(2)4-8(34)12-14(10)16-15(13)17-19(27(37)23(31)29(39)21(17)25(11)35)20-18(16)22(26(12)36)30(40)24(32)28(20)38/h3-4,35-40H,1-2H3 |
| InChIKey | GVMGQHHCKWJOTF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nephroma laevigatum (ncbitaxon:203386) | - | DOI (10.1021/np50118a006) |
| Roles Classification |
|---|
| Biological Role: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. |
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7,7'-Dichlorohypericin (CHEBI:200438) is a ortho- and peri-fused polycyclic arene (CHEBI:35300) |
| IUPAC Name |
|---|
| 12,17-dichloro-9,11,13,16,18,20-hexahydroxy-5,24-dimethyloctacyclo[13.11.1.12,10.03,8.04,25.019,27.021,26.014,28]octacosa-1(27),2(28),3(8),4(25),5,9,11,13,15,17,19,21(26),23-tridecaene-7,22-dione |
| Manual Xrefs | Databases |
|---|---|
| 78435934 | ChemSpider |