EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N2O2 |
| Net Charge | 0 |
| Average Mass | 200.282 |
| Monoisotopic Mass | 200.15248 |
| SMILES | CCCCC=C[N+]([O-])=NC(C)C(C)O |
| InChI | InChI=1S/C10H20N2O2/c1-4-5-6-7-8-12(14)11-9(2)10(3)13/h7-10,13H,4-6H2,1-3H3 |
| InChIKey | YSGFBXZSDXVSLM-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (2584134) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maniwamycin B (CHEBI:200432) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| hex-1-enyl-(3-hydroxybutan-2-ylimino)-oxidoazanium |