EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27N3O10 |
| Net Charge | 0 |
| Average Mass | 397.381 |
| Monoisotopic Mass | 397.16964 |
| SMILES | NC(CC(O)C(N)CC(N[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H27N3O10/c15-4(7(19)2-5(16)13(23)24)1-6(14(25)26)17-12-11(22)10(21)9(20)8(3-18)27-12/h4-12,17-22H,1-3,15-16H2,(H,23,24)(H,25,26)/t4?,5?,6?,7?,8-,9-,10+,11-,12-/m1/s1 |
| InChIKey | RETMXMAOYGZCRA-KVCVDMSMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ascochyta caulina (ncbitaxon:565413) | - | DOI (10.1016/s0031-9422(97)01072-8) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ascaulitoxin (CHEBI:200428) is a glyco-amino acid (CHEBI:35258) |
| IUPAC Name |
|---|
| 2,5-diamino-4-hydroxy-7-[[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]amino]octanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 8772311 | ChemSpider |