EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H26O2 |
| Net Charge | 0 |
| Average Mass | 274.404 |
| Monoisotopic Mass | 274.19328 |
| SMILES | C=CCc1cc(C)ccc1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H26O2/c1-3-9-17-14-15(2)12-13-16(17)10-7-5-4-6-8-11-18(19)20/h3,12-14H,1,4-11H2,2H3,(H,19,20) |
| InChIKey | WQSRLGOQJXDJSY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Solwarasporaspecies (ncbitaxon:1912063) | - | PubMed (24534844) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Solwaric acid A (CHEBI:200412) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 8-(4-methyl-2-prop-2-enylphenyl)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 32674771 | ChemSpider |