EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O7 |
| Net Charge | 0 |
| Average Mass | 344.404 |
| Monoisotopic Mass | 344.18350 |
| SMILES | CC(=O)OCCCCC[C@H]1OC(=O)[C@H](C)[C@H](O)[C@@H](O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C17H28O7/c1-10-15(19)16(20)14-8-7-13(23-14)12(24-17(10)21)6-4-3-5-9-22-11(2)18/h10,12-16,19-20H,3-9H2,1-2H3/t10-,12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | AXMYBKVKZPWGTH-BAGFCZJQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytosporaspecies (ncbitaxon:1715226) | - | PubMed (22011230) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cytospolide N (CHEBI:200384) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 5-[(1S,2R,5R,6S,7R,8R)-6,7-dihydroxy-5-methyl-4-oxo-3,11-dioxabicyclo[6.2.1]undecan-2-yl]pentyl acetate |
| Manual Xrefs | Databases |
|---|---|
| 78436612 | ChemSpider |