EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H34O4 |
| Net Charge | 0 |
| Average Mass | 386.532 |
| Monoisotopic Mass | 386.24571 |
| SMILES | C/C=C(/CCCCCCCCC/C=C\C=C\Cc1cc(O)cc(O)c1)C(=O)O |
| InChI | InChI=1S/C24H34O4/c1-2-21(24(27)28)16-14-12-10-8-6-4-3-5-7-9-11-13-15-20-17-22(25)19-23(26)18-20/h2,7,9,11,13,17-19,25-26H,3-6,8,10,12,14-16H2,1H3,(H,27,28)/b9-7-,13-11+,21-2- |
| InChIKey | FTTCIXYIAKUQIU-NKZFWQJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arcopilus aureus (ncbitaxon:79815) | - | PubMed (25482429) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Chaetorcinol (CHEBI:200318) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (2Z,12Z,14E)-16-(3,5-dihydroxyphenyl)-2-ethylidenehexadeca-12,14-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78434656 | ChemSpider |