EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H35NO4 |
| Net Charge | 0 |
| Average Mass | 413.558 |
| Monoisotopic Mass | 413.25661 |
| SMILES | C/C=C/C=C/[C@H]1C(C)=C[C@H]2C[C@@H](C)CC[C@@H]2[C@@]1(C)/C(O)=C1/C(=O)[C@@H](CO)N(C)C1=O |
| InChI | InChI=1S/C25H35NO4/c1-6-7-8-9-18-16(3)13-17-12-15(2)10-11-19(17)25(18,4)23(29)21-22(28)20(14-27)26(5)24(21)30/h6-9,13,15,17-20,27,29H,10-12,14H2,1-5H3/b7-6+,9-8+,23-21+/t15-,17+,18-,19-,20+,25-/m0/s1 |
| InChIKey | GQYNYOOJEMDNNZ-KXBMYEHISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Phomaspecies (ncbitaxon:1707701) | - | DOI (10.1016/s0040-4039(98)00269-x) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phomasetin (CHEBI:200307) is a N-alkylpyrrolidine (CHEBI:46775) |
| IUPAC Name |
|---|
| (3E,5R)-3-[[(1R,2S,4aR,6S,8aS)-1,3,6-trimethyl-2-[(1E,3E)-penta-1,3-dienyl]-4a,5,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-hydroxymethylidene]-5-(hydroxymethyl)-1-methylpyrrolidine-2,4-dione |
| Manual Xrefs | Databases |
|---|---|
| 78440076 | ChemSpider |