EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H33NO4 |
| Net Charge | 0 |
| Average Mass | 387.520 |
| Monoisotopic Mass | 387.24096 |
| SMILES | CCCCCCCC(=O)C/C(=C\c1cc(CCC)ncc1C(=O)OC)C(C)=O |
| InChI | InChI=1S/C23H33NO4/c1-5-7-8-9-10-12-21(26)15-18(17(3)25)13-19-14-20(11-6-2)24-16-22(19)23(27)28-4/h13-14,16H,5-12,15H2,1-4H3/b18-13+ |
| InChIKey | IWAPLOITRVNZAP-QGOAFFKASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Monascus purpureus (ncbitaxon:5098) | - | DOI (10.1002/hlca.201100017) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 4-[(E)-2-acetyl-4-oxoundec-1-enyl]-6-propylnicotinate (CHEBI:200298) is a aromatic carboxylic acid (CHEBI:33859) |
| methyl 4-[(E)-2-acetyl-4-oxoundec-1-enyl]-6-propylnicotinate (CHEBI:200298) is a pyridines (CHEBI:26421) |
| IUPAC Name |
|---|
| methyl 4-[(E)-2-acetyl-4-oxoundec-1-enyl]-6-propylpyridine-3-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78435584 | ChemSpider |