EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H20O6 |
| Net Charge | 0 |
| Average Mass | 356.374 |
| Monoisotopic Mass | 356.12599 |
| SMILES | CC=C[C@H]1[C@H]2C(=O)c3c(O)c(C)c(O)c(C)c3[C@]1(C(=O)O)C(=O)C=C2C |
| InChI | InChI=1S/C20H20O6/c1-5-6-11-13-8(2)7-12(21)20(11,19(25)26)15-9(3)16(22)10(4)17(23)14(15)18(13)24/h5-7,11,13,22-23H,1-4H3,(H,25,26)/t11-,13-,20+/m0/s1 |
| InChIKey | HBCFRLHQVKWAKE-HGFQGUBDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium terrestre (ncbitaxon:374132) | - | DOI (10.1016/j.tetlet.2011.11.038) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sorbiterrin A (CHEBI:200267) is a naphthoic acid (CHEBI:25483) |
| IUPAC Name |
|---|
| (1S,9R,13S)-4,6-dihydroxy-3,5,10-trimethyl-8,12-dioxo-13-prop-1-enyltricyclo[7.3.1.02,7]trideca-2,4,6,10-tetraene-1-carboxylic acid |