EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20N2O |
| Net Charge | 0 |
| Average Mass | 256.349 |
| Monoisotopic Mass | 256.15756 |
| SMILES | CN1C[C@@](C)(O)C[C@@H]2c3cccc4ncc(c34)C[C@H]21 |
| InChI | InChI=1S/C16H20N2O/c1-16(19)7-12-11-4-3-5-13-15(11)10(8-17-13)6-14(12)18(2)9-16/h3-5,8,12,14,17,19H,6-7,9H2,1-2H3/t12-,14-,16+/m1/s1 |
| InChIKey | PYBBWVXSIFAQEZ-XPKDYRNWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Claviceps paspali (ncbitaxon:40601) | - | PubMed (4219404) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dihydrosetoclavine (CHEBI:200230) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (6aR,9S,10aR)-7,9-dimethyl-4,6,6a,8,10,10a-hexahydroindolo[4,3-g]quinolin-9-ol |
| Manual Xrefs | Databases |
|---|---|
| 58828641 | ChemSpider |