EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O9 |
| Net Charge | 0 |
| Average Mass | 494.581 |
| Monoisotopic Mass | 494.25158 |
| SMILES | C=C[C@]1(C)C=C2C=C[C@@H]3[C@](C)(C[C@@H](O)[C@@H](O)[C@]3(C)COC3OC(C(=O)O)C(O)C(O)C3O)[C@H]2CC1 |
| InChI | InChI=1S/C26H38O9/c1-5-24(2)9-8-14-13(10-24)6-7-16-25(14,3)11-15(27)21(31)26(16,4)12-34-23-19(30)17(28)18(29)20(35-23)22(32)33/h5-7,10,14-21,23,27-31H,1,8-9,11-12H2,2-4H3,(H,32,33)/t14-,15+,16+,17?,18?,19?,20?,21+,23?,24-,25+,26+/m0/s1 |
| InChIKey | DWAYJEOEXYXHTI-ZNEGHLHHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sagenomella striatispora (ncbitaxon:743106) | - | PubMed (21922899) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Virescenoside Z8 (CHEBI:200214) is a steroid saponin (CHEBI:61655) |
| IUPAC Name |
|---|
| 6-[[(1S,2S,3R,4aR,4bR,7R,10aR)-7-ethenyl-2,3-dihydroxy-1,4a,7-trimethyl-3,4,4b,5,6,10a-hexahydro-2H-phenanthren-1-yl]methoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 27022402 | ChemSpider |