EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O3 |
| Net Charge | 0 |
| Average Mass | 248.322 |
| Monoisotopic Mass | 248.14124 |
| SMILES | [H][C@@]12CC(C)(C)CC3=C(C)C(=O)C[C@@]3([H])[C@]1(C(=O)O)C2 |
| InChI | InChI=1S/C15H20O3/c1-8-10-7-14(2,3)5-9-6-15(9,13(17)18)11(10)4-12(8)16/h9,11H,4-7H2,1-3H3,(H,17,18)/t9-,11+,15-/m0/s1 |
| InChIKey | STEFDXGKULBYNU-ISOBSLSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clonostachys compactiuscula (ncbitaxon:122660) | cell culture (BTO:0000214) | PubMed (32139881) | Strain: FKR-0021 |
| Ophioceras venezuelense (ncbitaxon:85945) | - | PubMed (15921413) | |
| Trichoderma harzianum (ncbitaxon:5544) | - | PubMed (32318046) | Strain: XS-20090075 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ophioceric acid (CHEBI:200207) has functional parent 2-dehydroxy-2-en-4-oxoafricanol (CHEBI:234489) |
| ophioceric acid (CHEBI:200207) has role fungal metabolite (CHEBI:76946) |
| ophioceric acid (CHEBI:200207) is a carbotricyclic compound (CHEBI:38032) |
| ophioceric acid (CHEBI:200207) is a cyclic ketone (CHEBI:3992) |
| ophioceric acid (CHEBI:200207) is a enone (CHEBI:51689) |
| ophioceric acid (CHEBI:200207) is a monocarboxylic acid (CHEBI:25384) |
| ophioceric acid (CHEBI:200207) is a sesquiterpenoid (CHEBI:26658) |
| ophioceric acid (CHEBI:200207) is conjugate acid of ophiocerate (CHEBI:234490) |
| Incoming Relation(s) |
| ophiocerate (CHEBI:234490) is conjugate base of ophioceric acid (CHEBI:200207) |
| IUPAC Name |
|---|
| (1aS,7aR,7bS)-3,3,5-trimethyl-6-oxo-1,1a,2,3,4,6,7,7a-octahydro-7bH-cyclopropa[e]azulene-7b-carboxylic acid |
| Synonym | Source |
|---|---|
| (+)-ophioceric acid | ChEBI |
| Citations |
|---|