EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O4 |
| Net Charge | 0 |
| Average Mass | 158.153 |
| Monoisotopic Mass | 158.05791 |
| SMILES | C=C(C(=O)O)[C@H](CC)C(=O)O |
| InChI | InChI=1S/C7H10O4/c1-3-5(7(10)11)4(2)6(8)9/h5H,2-3H2,1H3,(H,8,9)(H,10,11)/t5-/m0/s1 |
| InChIKey | JYLVYKQVUQBCBP-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Graphis scripta (ncbitaxon:71600) | - | DOI (10.3987/com-14-13107) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+/-)-ethylitaconic acid (CHEBI:200136) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| 2-ethyl-3-methylidenebutanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 11325997 | ChemSpider |