EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22O4 |
| Net Charge | 0 |
| Average Mass | 326.392 |
| Monoisotopic Mass | 326.15181 |
| SMILES | C=Cc1c(C)cc(O)c2c1[C@H](O)[C@H]1OC(=O)[C@]3(C)CC[C@@H]4C[C@@]24[C@H]13 |
| InChI | InChI=1S/C20H22O4/c1-4-11-9(2)7-12(21)14-13(11)15(22)16-17-19(3,18(23)24-16)6-5-10-8-20(10,14)17/h4,7,10,15-17,21-22H,1,5-6,8H2,2-3H3/t10-,15+,16-,17-,19-,20+/m1/s1 |
| InChIKey | BPOZHKIQPZGPLK-RVBQMODWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arthriniumspecies (ncbitaxon:1756131) | - | PubMed (21741249) |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arthrinin A (CHEBI:200134) is a phenanthrenes (CHEBI:25961) |
| IUPAC Name |
|---|
| (1R,8S,9S,12R,15R,17S)-6-ethenyl-3,8-dihydroxy-5,12-dimethyl-10-oxapentacyclo[7.7.1.01,15.02,7.012,17]heptadeca-2,4,6-trien-11-one |
| Manual Xrefs | Databases |
|---|---|
| 26633270 | ChemSpider |