EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28O6 |
| Net Charge | 0 |
| Average Mass | 532.592 |
| Monoisotopic Mass | 532.18859 |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@]23OC(=O)[C@@](O)(Cc4ccccc4)[C@]2(O[C@H]3c2ccccc2)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C34H28O6/c35-28-21-27(24-15-7-2-8-16-24)33-29(25-17-9-3-10-18-25)39-34(33,32(28,38)26-19-11-4-12-20-26)31(37,30(36)40-33)22-23-13-5-1-6-14-23/h1-20,27,29,37-38H,21-22H2/t27-,29-,31-,32-,33+,34-/m0/s1 |
| InChIKey | GFAMJDLEQYJMPF-DLMDRUJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kyrtuthrix (ncbitaxon:1906669) | - | PubMed (9548830) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Maculalactone K (CHEBI:200124) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (1R,2R,5S,6R,9R,11S)-9-benzyl-2,9-dihydroxy-2,5,11-triphenyl-7,10-dioxatricyclo[4.3.2.01,6]undecane-3,8-dione |
| Manual Xrefs | Databases |
|---|---|
| 78440068 | ChemSpider |